C22H23N3O3 — CID 9252560
N-(2,5-dimethylpyrrol-1-yl)-4-[2-(3-methylanilino)-2-oxoethoxy]benzamide (PubChem CID 9252560) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is N-(2,5-dimethylpyrrol-1-yl)-4-[2-(3-methylanilino)-2-oxoethoxy]benzamide.
| Compound Name | N-(2,5-dimethylpyrrol-1-yl)-4-[2-(3-methylanilino)-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 9252560 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-(2,5-dimethylpyrrol-1-yl)-4-[2-(3-methylanilino)-2-oxoethoxy]benzamide |
| SMILES | Cc1cccc(NC(=O)COc2ccc(C(=O)Nn3c(C)ccc3C)cc2)c1 |
| InChI | InChI=1S/C22H23N3O3/c1-15-5-4-6-19(13-15)23-21(26)14-28-20-11-9-18(10-12-20)22(27)24-25-16(2)7-8-17(25)3/h4-13H,14H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | JNJAHDYMVVDGRR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |