C20H20Cl2N2O2S — CID 126227959
N-(3,4-dichlorophenyl)-2-[4-(piperidine-1-carbothioyl)phenoxy]acetamide (PubChem CID 126227959) has the molecular formula C20H20Cl2N2O2S and a molecular weight of 423.37 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-[4-(piperidine-1-carbothioyl)phenoxy]acetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-[4-(piperidine-1-carbothioyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 126227959 |
| Molecular Formula | C20H20Cl2N2O2S |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-[4-(piperidine-1-carbothioyl)phenoxy]acetamide |
| SMILES | O=C(COc1ccc(C(=S)N2CCCCC2)cc1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H20Cl2N2O2S/c21-17-9-6-15(12-18(17)22)23-19(25)13-26-16-7-4-14(5-8-16)20(27)24-10-2-1-3-11-24/h4-9,12H,1-3,10-11,13H2,(H,23,25) |
| InChIKey | VCUJOZMAWDBMOQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|