C20H15Cl2NO3 — CID 2319916
N-(3,4-dichlorophenyl)-2-(4-phenoxyphenoxy)acetamide (PubChem CID 2319916) has the molecular formula C20H15Cl2NO3 and a molecular weight of 388.25 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-(4-phenoxyphenoxy)acetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-(4-phenoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 2319916 |
| Molecular Formula | C20H15Cl2NO3 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-(4-phenoxyphenoxy)acetamide |
| SMILES | O=C(COc1ccc(Oc2ccccc2)cc1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H15Cl2NO3/c21-18-11-6-14(12-19(18)22)23-20(24)13-25-15-7-9-17(10-8-15)26-16-4-2-1-3-5-16/h1-12H,13H2,(H,23,24) |
| InChIKey | VLNRYRSYUIZZEH-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |