C22H21FN4O — CID 76856898
N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-3-phenylprop-2-enamide (PubChem CID 76856898) has the molecular formula C22H21FN4O and a molecular weight of 376.44 g/mol. Its IUPAC name is N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-3-phenylprop-2-enamide.
| Compound Name | N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 76856898 |
| Molecular Formula | C22H21FN4O |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-3-phenylprop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1)Nc1cc(-c2nnc3n2CCCCC3)ccc1F |
| InChI | InChI=1S/C22H21FN4O/c23-18-12-11-17(22-26-25-20-9-5-2-6-14-27(20)22)15-19(18)24-21(28)13-10-16-7-3-1-4-8-16/h1,3-4,7-8,10-13,15H,2,5-6,9,14H2,(H,24,28) |
| InChIKey | KSWXYMIHODINBB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|