C22H22N4OS — CID 86902945
(E)-3-(4-methylsulfanylphenyl)-N-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]prop-2-enamide (PubChem CID 86902945) has the molecular formula C22H22N4OS and a molecular weight of 390.51 g/mol. Its IUPAC name is (E)-3-(4-methylsulfanylphenyl)-N-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(4-methylsulfanylphenyl)-N-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 86902945 |
| Molecular Formula | C22H22N4OS |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | (E)-3-(4-methylsulfanylphenyl)-N-[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]prop-2-enamide |
| SMILES | CSc1ccc(/C=C/C(=O)Nc2ccc(-c3nnc4n3CCCC4)cc2)cc1 |
| InChI | InChI=1S/C22H22N4OS/c1-28-19-12-5-16(6-13-19)7-14-21(27)23-18-10-8-17(9-11-18)22-25-24-20-4-2-3-15-26(20)22/h5-14H,2-4,15H2,1H3,(H,23,27)/b14-7+ |
| InChIKey | UCIWBGOYLLPUDQ-VGOFMYFVSA-N |
| XLogP | 4.66 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|