C20H20N4OS — CID 6074737
(E)-N-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 6074737) has the molecular formula C20H20N4OS and a molecular weight of 364.47 g/mol. Its IUPAC name is (E)-N-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 6074737 |
| Molecular Formula | C20H20N4OS |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | (E)-N-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccs1)Nc1ccc(-c2nnc3n2CCCCC3)cc1 |
| InChI | InChI=1S/C20H20N4OS/c25-19(12-11-17-5-4-14-26-17)21-16-9-7-15(8-10-16)20-23-22-18-6-2-1-3-13-24(18)20/h4-5,7-12,14H,1-3,6,13H2,(H,21,25)/b12-11+ |
| InChIKey | PORKCZIJPGYFFV-VAWYXSNFSA-N |
| XLogP | 4.38 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|