C14H19F2NO2 — CID 129149337
1-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]piperidine (PubChem CID 129149337) has the molecular formula C14H19F2NO2 and a molecular weight of 271.31 g/mol. Its IUPAC name is 1-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]piperidine.
| Compound Name | 1-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]piperidine |
|---|---|
| PubChem CID | 129149337 |
| Molecular Formula | C14H19F2NO2 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 1-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]piperidine |
| SMILES | COCCOc1cc(F)c(N2CCCCC2)c(F)c1 |
| InChI | InChI=1S/C14H19F2NO2/c1-18-7-8-19-11-9-12(15)14(13(16)10-11)17-5-3-2-4-6-17/h9-10H,2-8H2,1H3 |
| InChIKey | DCRQCFKSMYUTRC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|