C17H26F2N2O2 — CID 138741639
1-tert-butyl-4-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]piperazine (PubChem CID 138741639) has the molecular formula C17H26F2N2O2 and a molecular weight of 328.40 g/mol. Its IUPAC name is 1-tert-butyl-4-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]piperazine.
| Compound Name | 1-tert-butyl-4-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]piperazine |
|---|---|
| PubChem CID | 138741639 |
| Molecular Formula | C17H26F2N2O2 |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 1-tert-butyl-4-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]piperazine |
| SMILES | COCCOc1cc(F)c(N2CCN(C(C)(C)C)CC2)c(F)c1 |
| InChI | InChI=1S/C17H26F2N2O2/c1-17(2,3)21-7-5-20(6-8-21)16-14(18)11-13(12-15(16)19)23-10-9-22-4/h11-12H,5-10H2,1-4H3 |
| InChIKey | LAZSIHJFYONEJS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|