C20H32F2N4O — CID 129149269
1-[2,6-difluoro-4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]-4-propan-2-ylpiperazine (PubChem CID 129149269) has the molecular formula C20H32F2N4O and a molecular weight of 382.50 g/mol. Its IUPAC name is 1-[2,6-difluoro-4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]-4-propan-2-ylpiperazine.
| Compound Name | 1-[2,6-difluoro-4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]-4-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 129149269 |
| Molecular Formula | C20H32F2N4O |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 1-[2,6-difluoro-4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]-4-propan-2-ylpiperazine |
| SMILES | CC(C)N1CCN(c2c(F)cc(OCCN3CCN(C)CC3)cc2F)CC1 |
| InChI | InChI=1S/C20H32F2N4O/c1-16(2)25-8-10-26(11-9-25)20-18(21)14-17(15-19(20)22)27-13-12-24-6-4-23(3)5-7-24/h14-16H,4-13H2,1-3H3 |
| InChIKey | CPMALHRSESLQBZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 22.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|