C17H26F2N2O — CID 129149317
1-[2,6-difluoro-4-(3-methoxypropyl)phenyl]-4-propan-2-ylpiperazine (PubChem CID 129149317) has the molecular formula C17H26F2N2O and a molecular weight of 312.40 g/mol. Its IUPAC name is 1-[2,6-difluoro-4-(3-methoxypropyl)phenyl]-4-propan-2-ylpiperazine.
| Compound Name | 1-[2,6-difluoro-4-(3-methoxypropyl)phenyl]-4-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 129149317 |
| Molecular Formula | C17H26F2N2O |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 1-[2,6-difluoro-4-(3-methoxypropyl)phenyl]-4-propan-2-ylpiperazine |
| SMILES | COCCCc1cc(F)c(N2CCN(C(C)C)CC2)c(F)c1 |
| InChI | InChI=1S/C17H26F2N2O/c1-13(2)20-6-8-21(9-7-20)17-15(18)11-14(12-16(17)19)5-4-10-22-3/h11-13H,4-10H2,1-3H3 |
| InChIKey | OOULQYHNYMKBAY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|