C13H19F2N3O — CID 118648209
3,5-difluoro-N-(2-methoxyethyl)-4-piperazin-1-ylaniline (PubChem CID 118648209) has the molecular formula C13H19F2N3O and a molecular weight of 271.31 g/mol. Its IUPAC name is 3,5-difluoro-N-(2-methoxyethyl)-4-piperazin-1-ylaniline.
| Compound Name | 3,5-difluoro-N-(2-methoxyethyl)-4-piperazin-1-ylaniline |
|---|---|
| PubChem CID | 118648209 |
| Molecular Formula | C13H19F2N3O |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 3,5-difluoro-N-(2-methoxyethyl)-4-piperazin-1-ylaniline |
| SMILES | COCCNc1cc(F)c(N2CCNCC2)c(F)c1 |
| InChI | InChI=1S/C13H19F2N3O/c1-19-7-4-17-10-8-11(14)13(12(15)9-10)18-5-2-16-3-6-18/h8-9,16-17H,2-7H2,1H3 |
| InChIKey | ALFDSFHDSAGCSI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|