C18H27F2N3O3 — CID 140787571
tert-butyl 4-[2,6-difluoro-4-(2-methoxyethylamino)phenyl]piperazine-1-carboxylate (PubChem CID 140787571) has the molecular formula C18H27F2N3O3 and a molecular weight of 371.43 g/mol. Its IUPAC name is tert-butyl 4-[2,6-difluoro-4-(2-methoxyethylamino)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2,6-difluoro-4-(2-methoxyethylamino)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 140787571 |
| Molecular Formula | C18H27F2N3O3 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | tert-butyl 4-[2,6-difluoro-4-(2-methoxyethylamino)phenyl]piperazine-1-carboxylate |
| SMILES | COCCNc1cc(F)c(N2CCN(C(=O)OC(C)(C)C)CC2)c(F)c1 |
| InChI | InChI=1S/C18H27F2N3O3/c1-18(2,3)26-17(24)23-8-6-22(7-9-23)16-14(19)11-13(12-15(16)20)21-5-10-25-4/h11-12,21H,5-10H2,1-4H3 |
| InChIKey | GMBGWDJUOIIWFF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|