C21H29F2N3O4 — CID 118648230
tert-butyl 4-[2,6-difluoro-4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]piperazine-1-carboxylate (PubChem CID 118648230) has the molecular formula C21H29F2N3O4 and a molecular weight of 425.48 g/mol. Its IUPAC name is tert-butyl 4-[2,6-difluoro-4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2,6-difluoro-4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 118648230 |
| Molecular Formula | C21H29F2N3O4 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | tert-butyl 4-[2,6-difluoro-4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2c(F)cc(OCC(=O)N3CCCC3)cc2F)CC1 |
| InChI | InChI=1S/C21H29F2N3O4/c1-21(2,3)30-20(28)26-10-8-25(9-11-26)19-16(22)12-15(13-17(19)23)29-14-18(27)24-6-4-5-7-24/h12-13H,4-11,14H2,1-3H3 |
| InChIKey | FLUHTSTXZUCXFM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|