C17H25N3O4 — CID 58795972
tert-butyl 4-[2-(3-aminophenoxy)acetyl]piperazine-1-carboxylate (PubChem CID 58795972) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is tert-butyl 4-[2-(3-aminophenoxy)acetyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(3-aminophenoxy)acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58795972 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | tert-butyl 4-[2-(3-aminophenoxy)acetyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)COc2cccc(N)c2)CC1 |
| InChI | InChI=1S/C17H25N3O4/c1-17(2,3)24-16(22)20-9-7-19(8-10-20)15(21)12-23-14-6-4-5-13(18)11-14/h4-6,11H,7-10,12,18H2,1-3H3 |
| InChIKey | URCMXIZLGBELNP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|