C16H21N3O5 — CID 51088119
ethyl 4-[2-(3-carbamoylphenoxy)acetyl]piperazine-1-carboxylate (PubChem CID 51088119) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is ethyl 4-[2-(3-carbamoylphenoxy)acetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-(3-carbamoylphenoxy)acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 51088119 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | ethyl 4-[2-(3-carbamoylphenoxy)acetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)COc2cccc(C(N)=O)c2)CC1 |
| InChI | InChI=1S/C16H21N3O5/c1-2-23-16(22)19-8-6-18(7-9-19)14(20)11-24-13-5-3-4-12(10-13)15(17)21/h3-5,10H,2,6-9,11H2,1H3,(H2,17,21) |
| InChIKey | KACFQFVQQOLUSA-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |