C14H17NO4 — CID 685737
2-(3-acetylphenoxy)-1-morpholin-4-ylethanone (PubChem CID 685737) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 2-(3-acetylphenoxy)-1-morpholin-4-ylethanone.
| Compound Name | 2-(3-acetylphenoxy)-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 685737 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 2-(3-acetylphenoxy)-1-morpholin-4-ylethanone |
| SMILES | CC(=O)c1cccc(OCC(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C14H17NO4/c1-11(16)12-3-2-4-13(9-12)19-10-14(17)15-5-7-18-8-6-15/h2-4,9H,5-8,10H2,1H3 |
| InChIKey | LWIPOAGPSACISD-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |