C15H21ClN2O3 — CID 119486393
2-(3-acetylphenoxy)-1-[3-(aminomethyl)pyrrolidin-1-yl]ethanone;hydrochloride (PubChem CID 119486393) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is 2-(3-acetylphenoxy)-1-[3-(aminomethyl)pyrrolidin-1-yl]ethanone;hydrochloride.
| Compound Name | 2-(3-acetylphenoxy)-1-[3-(aminomethyl)pyrrolidin-1-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 119486393 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 2-(3-acetylphenoxy)-1-[3-(aminomethyl)pyrrolidin-1-yl]ethanone;hydrochloride |
| SMILES | CC(=O)c1cccc(OCC(=O)N2CCC(CN)C2)c1.Cl |
| InChI | InChI=1S/C15H20N2O3.ClH/c1-11(18)13-3-2-4-14(7-13)20-10-15(19)17-6-5-12(8-16)9-17;/h2-4,7,12H,5-6,8-10,16H2,1H3;1H |
| InChIKey | KIDGCHMJIBMSAC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |