C17H24N2O3 — CID 120815322
2-(3-acetylphenoxy)-1-(4-amino-3,3-dimethylpiperidin-1-yl)ethanone (PubChem CID 120815322) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-(3-acetylphenoxy)-1-(4-amino-3,3-dimethylpiperidin-1-yl)ethanone.
| Compound Name | 2-(3-acetylphenoxy)-1-(4-amino-3,3-dimethylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 120815322 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 2-(3-acetylphenoxy)-1-(4-amino-3,3-dimethylpiperidin-1-yl)ethanone |
| SMILES | CC(=O)c1cccc(OCC(=O)N2CCC(N)C(C)(C)C2)c1 |
| InChI | InChI=1S/C17H24N2O3/c1-12(20)13-5-4-6-14(9-13)22-10-16(21)19-8-7-15(18)17(2,3)11-19/h4-6,9,15H,7-8,10-11,18H2,1-3H3 |
| InChIKey | OXOZJGXRLXFEQG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |