C20H28N2O6 — CID 98010789
tert-butyl N-[[(2S)-4-[2-(3-acetylphenoxy)acetyl]morpholin-2-yl]methyl]carbamate (PubChem CID 98010789) has the molecular formula C20H28N2O6 and a molecular weight of 392.45 g/mol. Its IUPAC name is tert-butyl N-[[(2S)-4-[2-(3-acetylphenoxy)acetyl]morpholin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(2S)-4-[2-(3-acetylphenoxy)acetyl]morpholin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 98010789 |
| Molecular Formula | C20H28N2O6 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | tert-butyl N-[[(2S)-4-[2-(3-acetylphenoxy)acetyl]morpholin-2-yl]methyl]carbamate |
| SMILES | CC(=O)c1cccc(OCC(=O)N2CCO[C@@H](CNC(=O)OC(C)(C)C)C2)c1 |
| InChI | InChI=1S/C20H28N2O6/c1-14(23)15-6-5-7-16(10-15)27-13-18(24)22-8-9-26-17(12-22)11-21-19(25)28-20(2,3)4/h5-7,10,17H,8-9,11-13H2,1-4H3,(H,21,25)/t17-/m0/s1 |
| InChIKey | REZCALVBIWQPMG-KRWDZBQOSA-N |
| XLogP | 2.02 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |