C13H26N2O3 — CID 163975726
tert-butyl N-[[(2R)-4-propan-2-ylmorpholin-2-yl]methyl]carbamate (PubChem CID 163975726) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is tert-butyl N-[[(2R)-4-propan-2-ylmorpholin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(2R)-4-propan-2-ylmorpholin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 163975726 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | tert-butyl N-[[(2R)-4-propan-2-ylmorpholin-2-yl]methyl]carbamate |
| SMILES | CC(C)N1CCO[C@H](CNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C13H26N2O3/c1-10(2)15-6-7-17-11(9-15)8-14-12(16)18-13(3,4)5/h10-11H,6-9H2,1-5H3,(H,14,16)/t11-/m1/s1 |
| InChIKey | STYLPACGMKRLFN-LLVKDONJSA-N |
| XLogP | 1.62 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |