C15H32IN5O3 — CID 111884988
tert-butyl N-[2-[[N'-methyl-N-[(4-methylmorpholin-2-yl)methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 111884988) has the molecular formula C15H32IN5O3 and a molecular weight of 457.36 g/mol. Its IUPAC name is tert-butyl N-[2-[[N'-methyl-N-[(4-methylmorpholin-2-yl)methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N'-methyl-N-[(4-methylmorpholin-2-yl)methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111884988 |
| Molecular Formula | C15H32IN5O3 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | tert-butyl N-[2-[[N'-methyl-N-[(4-methylmorpholin-2-yl)methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)OC(C)(C)C)NCC1CN(C)CCO1.I |
| InChI | InChI=1S/C15H31N5O3.HI/c1-15(2,3)23-14(21)18-7-6-17-13(16-4)19-10-12-11-20(5)8-9-22-12;/h12H,6-11H2,1-5H3,(H,18,21)(H2,16,17,19);1H |
| InChIKey | ZDAUXFOSGGDFJO-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|