C17H35N5O2 — CID 111884169
tert-butyl N-[2-[[N'-methyl-N-[2-(1-methylpiperidin-4-yl)ethyl]carbamimidoyl]amino]ethyl]carbamate (PubChem CID 111884169) has the molecular formula C17H35N5O2 and a molecular weight of 341.50 g/mol. Its IUPAC name is tert-butyl N-[2-[[N'-methyl-N-[2-(1-methylpiperidin-4-yl)ethyl]carbamimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[N'-methyl-N-[2-(1-methylpiperidin-4-yl)ethyl]carbamimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111884169 |
| Molecular Formula | C17H35N5O2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.28 |
| IUPAC Name | tert-butyl N-[2-[[N'-methyl-N-[2-(1-methylpiperidin-4-yl)ethyl]carbamimidoyl]amino]ethyl]carbamate |
| SMILES | C/N=C(\NCCNC(=O)OC(C)(C)C)NCCC1CCN(C)CC1 |
| InChI | InChI=1S/C17H35N5O2/c1-17(2,3)24-16(23)21-11-10-20-15(18-4)19-9-6-14-7-12-22(5)13-8-14/h14H,6-13H2,1-5H3,(H,21,23)(H2,18,19,20) |
| InChIKey | CRUWBDRLGLCPPG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|