C15H31N5O2 — CID 170130136
tert-butyl N-[2-[1-[2-[(N'-methylcarbamimidoyl)amino]ethyl]pyrrolidin-3-yl]ethyl]carbamate (PubChem CID 170130136) has the molecular formula C15H31N5O2 and a molecular weight of 313.45 g/mol. Its IUPAC name is tert-butyl N-[2-[1-[2-[(N'-methylcarbamimidoyl)amino]ethyl]pyrrolidin-3-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-[2-[(N'-methylcarbamimidoyl)amino]ethyl]pyrrolidin-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 170130136 |
| Molecular Formula | C15H31N5O2 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | tert-butyl N-[2-[1-[2-[(N'-methylcarbamimidoyl)amino]ethyl]pyrrolidin-3-yl]ethyl]carbamate |
| SMILES | C/N=C(\N)NCCN1CCC(CCNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H31N5O2/c1-15(2,3)22-14(21)19-7-5-12-6-9-20(11-12)10-8-18-13(16)17-4/h12H,5-11H2,1-4H3,(H,19,21)(H3,16,17,18) |
| InChIKey | YBONNHMHVHIJMG-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|