C17H37IN6O2 — CID 111883858
tert-butyl N-[2-[[N'-methyl-N-[2-(4-methylpiperazin-1-yl)propyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 111883858) has the molecular formula C17H37IN6O2 and a molecular weight of 484.43 g/mol. Its IUPAC name is tert-butyl N-[2-[[N'-methyl-N-[2-(4-methylpiperazin-1-yl)propyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N'-methyl-N-[2-(4-methylpiperazin-1-yl)propyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111883858 |
| Molecular Formula | C17H37IN6O2 |
| Molecular Weight | 484.43 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | tert-butyl N-[2-[[N'-methyl-N-[2-(4-methylpiperazin-1-yl)propyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)OC(C)(C)C)NCC(C)N1CCN(C)CC1.I |
| InChI | InChI=1S/C17H36N6O2.HI/c1-14(23-11-9-22(6)10-12-23)13-21-15(18-5)19-7-8-20-16(24)25-17(2,3)4;/h14H,7-13H2,1-6H3,(H,20,24)(H2,18,19,21);1H |
| InChIKey | XEQFFNATLDFLRD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.43 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|