C18H38N6O2 — CID 111885039
tert-butyl N-[2-[[N-[2-(4-ethylpiperazin-1-yl)propyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate (PubChem CID 111885039) has the molecular formula C18H38N6O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-[2-(4-ethylpiperazin-1-yl)propyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[N-[2-(4-ethylpiperazin-1-yl)propyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111885039 |
| Molecular Formula | C18H38N6O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.31 |
| IUPAC Name | tert-butyl N-[2-[[N-[2-(4-ethylpiperazin-1-yl)propyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate |
| SMILES | CCN1CCN(C(C)CN/C(=N/C)NCCNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H38N6O2/c1-7-23-10-12-24(13-11-23)15(2)14-22-16(19-6)20-8-9-21-17(25)26-18(3,4)5/h15H,7-14H2,1-6H3,(H,21,25)(H2,19,20,22) |
| InChIKey | NTMNUEAGLKPJHD-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|