C20H44N6 — CID 111692770
1-[3-[di(propan-2-yl)amino]propyl]-3-[2-(4-ethylpiperazin-1-yl)propyl]-2-methylguanidine (PubChem CID 111692770) has the molecular formula C20H44N6 and a molecular weight of 368.61 g/mol. Its IUPAC name is 1-[3-[di(propan-2-yl)amino]propyl]-3-[2-(4-ethylpiperazin-1-yl)propyl]-2-methylguanidine.
| Compound Name | 1-[3-[di(propan-2-yl)amino]propyl]-3-[2-(4-ethylpiperazin-1-yl)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111692770 |
| Molecular Formula | C20H44N6 |
| Molecular Weight | 368.61 g/mol |
| Exact Mass | 368.36 |
| IUPAC Name | 1-[3-[di(propan-2-yl)amino]propyl]-3-[2-(4-ethylpiperazin-1-yl)propyl]-2-methylguanidine |
| SMILES | CCN1CCN(C(C)CN/C(=N/C)NCCCN(C(C)C)C(C)C)CC1 |
| InChI | InChI=1S/C20H44N6/c1-8-24-12-14-25(15-13-24)19(6)16-23-20(21-7)22-10-9-11-26(17(2)3)18(4)5/h17-19H,8-16H2,1-7H3,(H2,21,22,23) |
| InChIKey | SNPXRSQSYIOBQW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 46.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.61 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|