C23H40N6O2 — CID 111887321
tert-butyl N-[3-[[N'-methyl-N-[2-(4-phenylpiperazin-1-yl)propyl]carbamimidoyl]amino]propyl]carbamate (PubChem CID 111887321) has the molecular formula C23H40N6O2 and a molecular weight of 432.61 g/mol. Its IUPAC name is tert-butyl N-[3-[[N'-methyl-N-[2-(4-phenylpiperazin-1-yl)propyl]carbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N'-methyl-N-[2-(4-phenylpiperazin-1-yl)propyl]carbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111887321 |
| Molecular Formula | C23H40N6O2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | tert-butyl N-[3-[[N'-methyl-N-[2-(4-phenylpiperazin-1-yl)propyl]carbamimidoyl]amino]propyl]carbamate |
| SMILES | C/N=C(\NCCCNC(=O)OC(C)(C)C)NCC(C)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H40N6O2/c1-19(28-14-16-29(17-15-28)20-10-7-6-8-11-20)18-27-21(24-5)25-12-9-13-26-22(30)31-23(2,3)4/h6-8,10-11,19H,9,12-18H2,1-5H3,(H,26,30)(H2,24,25,27) |
| InChIKey | ODFMRWRKXRCBQD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|