C23H39N5O2 — CID 111645242
2-methyl-1-[3-(oxolan-3-ylmethoxy)propyl]-3-[2-(4-phenylpiperazin-1-yl)propyl]guanidine (PubChem CID 111645242) has the molecular formula C23H39N5O2 and a molecular weight of 417.60 g/mol. Its IUPAC name is 2-methyl-1-[3-(oxolan-3-ylmethoxy)propyl]-3-[2-(4-phenylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 2-methyl-1-[3-(oxolan-3-ylmethoxy)propyl]-3-[2-(4-phenylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111645242 |
| Molecular Formula | C23H39N5O2 |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.31 |
| IUPAC Name | 2-methyl-1-[3-(oxolan-3-ylmethoxy)propyl]-3-[2-(4-phenylpiperazin-1-yl)propyl]guanidine |
| SMILES | C/N=C(\NCCCOCC1CCOC1)NCC(C)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H39N5O2/c1-20(27-11-13-28(14-12-27)22-7-4-3-5-8-22)17-26-23(24-2)25-10-6-15-29-18-21-9-16-30-19-21/h3-5,7-8,20-21H,6,9-19H2,1-2H3,(H2,24,25,26) |
| InChIKey | LAKCSACEAOWCFN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|