C16H33N5O2 — CID 111887503
tert-butyl N-[3-[[N'-methyl-N-[(1-methylpyrrolidin-3-yl)methyl]carbamimidoyl]amino]propyl]carbamate (PubChem CID 111887503) has the molecular formula C16H33N5O2 and a molecular weight of 327.47 g/mol. Its IUPAC name is tert-butyl N-[3-[[N'-methyl-N-[(1-methylpyrrolidin-3-yl)methyl]carbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N'-methyl-N-[(1-methylpyrrolidin-3-yl)methyl]carbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111887503 |
| Molecular Formula | C16H33N5O2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | tert-butyl N-[3-[[N'-methyl-N-[(1-methylpyrrolidin-3-yl)methyl]carbamimidoyl]amino]propyl]carbamate |
| SMILES | C/N=C(\NCCCNC(=O)OC(C)(C)C)NCC1CCN(C)C1 |
| InChI | InChI=1S/C16H33N5O2/c1-16(2,3)23-15(22)19-9-6-8-18-14(17-4)20-11-13-7-10-21(5)12-13/h13H,6-12H2,1-5H3,(H,19,22)(H2,17,18,20) |
| InChIKey | BJHTVRMEJNWSMY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|