C20H32F2N2O — CID 166734159
2-[4-(azonan-1-yl)-3,5-difluorophenoxy]-N,N-diethylethanamine (PubChem CID 166734159) has the molecular formula C20H32F2N2O and a molecular weight of 354.49 g/mol. Its IUPAC name is 2-[4-(azonan-1-yl)-3,5-difluorophenoxy]-N,N-diethylethanamine.
| Compound Name | 2-[4-(azonan-1-yl)-3,5-difluorophenoxy]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 166734159 |
| Molecular Formula | C20H32F2N2O |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | 2-[4-(azonan-1-yl)-3,5-difluorophenoxy]-N,N-diethylethanamine |
| SMILES | CCN(CC)CCOc1cc(F)c(N2CCCCCCCC2)c(F)c1 |
| InChI | InChI=1S/C20H32F2N2O/c1-3-23(4-2)13-14-25-17-15-18(21)20(19(22)16-17)24-11-9-7-5-6-8-10-12-24/h15-16H,3-14H2,1-2H3 |
| InChIKey | HKCAKVGYDGFVEJ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|