C12H13BrF2N2O3 — CID 118648293
4-[4-(bromomethoxy)-2,6-difluorophenyl]piperazine-1-carboxylic acid (PubChem CID 118648293) has the molecular formula C12H13BrF2N2O3 and a molecular weight of 351.15 g/mol. Its IUPAC name is 4-[4-(bromomethoxy)-2,6-difluorophenyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[4-(bromomethoxy)-2,6-difluorophenyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 118648293 |
| Molecular Formula | C12H13BrF2N2O3 |
| Molecular Weight | 351.15 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | 4-[4-(bromomethoxy)-2,6-difluorophenyl]piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(c2c(F)cc(OCBr)cc2F)CC1 |
| InChI | InChI=1S/C12H13BrF2N2O3/c13-7-20-8-5-9(14)11(10(15)6-8)16-1-3-17(4-2-16)12(18)19/h5-6H,1-4,7H2,(H,18,19) |
| InChIKey | IUOPGDFMNMUBNZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.15 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|