C20H23F2N3O2 — CID 164518048
benzyl 4-[4-(2-aminoethyl)-2,6-difluorophenyl]piperazine-1-carboxylate (PubChem CID 164518048) has the molecular formula C20H23F2N3O2 and a molecular weight of 375.42 g/mol. Its IUPAC name is benzyl 4-[4-(2-aminoethyl)-2,6-difluorophenyl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[4-(2-aminoethyl)-2,6-difluorophenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 164518048 |
| Molecular Formula | C20H23F2N3O2 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | benzyl 4-[4-(2-aminoethyl)-2,6-difluorophenyl]piperazine-1-carboxylate |
| SMILES | NCCc1cc(F)c(N2CCN(C(=O)OCc3ccccc3)CC2)c(F)c1 |
| InChI | InChI=1S/C20H23F2N3O2/c21-17-12-16(6-7-23)13-18(22)19(17)24-8-10-25(11-9-24)20(26)27-14-15-4-2-1-3-5-15/h1-5,12-13H,6-11,14,23H2 |
| InChIKey | UPFRMNJRWPVCLO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |