C21H24F2N2O3 — CID 70652624
benzyl 4-[2,5-difluoro-4-(3-hydroxypropyl)phenyl]piperazine-1-carboxylate (PubChem CID 70652624) has the molecular formula C21H24F2N2O3 and a molecular weight of 390.43 g/mol. Its IUPAC name is benzyl 4-[2,5-difluoro-4-(3-hydroxypropyl)phenyl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[2,5-difluoro-4-(3-hydroxypropyl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 70652624 |
| Molecular Formula | C21H24F2N2O3 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | benzyl 4-[2,5-difluoro-4-(3-hydroxypropyl)phenyl]piperazine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCN(c2cc(F)c(CCCO)cc2F)CC1 |
| InChI | InChI=1S/C21H24F2N2O3/c22-18-14-20(19(23)13-17(18)7-4-12-26)24-8-10-25(11-9-24)21(27)28-15-16-5-2-1-3-6-16/h1-3,5-6,13-14,26H,4,7-12,15H2 |
| InChIKey | VXZSTQCYQWFWAK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |