C24H30FN3O2 — CID 20785559
benzyl 4-[2-fluoro-4-(1-pyrrolidin-1-ylethyl)phenyl]piperazine-1-carboxylate (PubChem CID 20785559) has the molecular formula C24H30FN3O2 and a molecular weight of 411.52 g/mol. Its IUPAC name is benzyl 4-[2-fluoro-4-(1-pyrrolidin-1-ylethyl)phenyl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[2-fluoro-4-(1-pyrrolidin-1-ylethyl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 20785559 |
| Molecular Formula | C24H30FN3O2 |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | benzyl 4-[2-fluoro-4-(1-pyrrolidin-1-ylethyl)phenyl]piperazine-1-carboxylate |
| SMILES | CC(c1ccc(N2CCN(C(=O)OCc3ccccc3)CC2)c(F)c1)N1CCCC1 |
| InChI | InChI=1S/C24H30FN3O2/c1-19(26-11-5-6-12-26)21-9-10-23(22(25)17-21)27-13-15-28(16-14-27)24(29)30-18-20-7-3-2-4-8-20/h2-4,7-10,17,19H,5-6,11-16,18H2,1H3 |
| InChIKey | DQGXDVJLDYOUOI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|