C22H23F2N3O5 — CID 91599707
benzyl 4-[2,6-difluoro-4-[(5R)-5-(hydroxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperazine-1-carboxylate (PubChem CID 91599707) has the molecular formula C22H23F2N3O5 and a molecular weight of 447.44 g/mol. Its IUPAC name is benzyl 4-[2,6-difluoro-4-[(5R)-5-(hydroxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[2,6-difluoro-4-[(5R)-5-(hydroxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 91599707 |
| Molecular Formula | C22H23F2N3O5 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | benzyl 4-[2,6-difluoro-4-[(5R)-5-(hydroxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperazine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCN(c2c(F)cc(N3C[C@H](CO)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C22H23F2N3O5/c23-18-10-16(27-12-17(13-28)32-22(27)30)11-19(24)20(18)25-6-8-26(9-7-25)21(29)31-14-15-4-2-1-3-5-15/h1-5,10-11,17,28H,6-9,12-14H2/t17-/m1/s1 |
| InChIKey | VDGQIEFBYUZYQS-QGZVFWFLSA-N |
| XLogP | 2.74 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|