C29H30FN3O7S — CID 76738945
benzyl 4-[2-fluoro-4-[5-[(4-methylphenyl)sulfonyloxymethyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperazine-1-carboxylate (PubChem CID 76738945) has the molecular formula C29H30FN3O7S and a molecular weight of 583.64 g/mol. Its IUPAC name is benzyl 4-[2-fluoro-4-[5-[(4-methylphenyl)sulfonyloxymethyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[2-fluoro-4-[5-[(4-methylphenyl)sulfonyloxymethyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 76738945 |
| Molecular Formula | C29H30FN3O7S |
| Molecular Weight | 583.64 g/mol |
| Exact Mass | 583.18 |
| IUPAC Name | benzyl 4-[2-fluoro-4-[5-[(4-methylphenyl)sulfonyloxymethyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CN(c3ccc(N4CCN(C(=O)OCc5ccccc5)CC4)c(F)c3)C(=O)O2)cc1 |
| InChI | InChI=1S/C29H30FN3O7S/c1-21-7-10-25(11-8-21)41(36,37)39-20-24-18-33(29(35)40-24)23-9-12-27(26(30)17-23)31-13-15-32(16-14-31)28(34)38-19-22-5-3-2-4-6-22/h2-12,17,24H,13-16,18-20H2,1H3 |
| InChIKey | PYVOUCPCBYMNRJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 105.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.64 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|