C23H25FN6O4 — CID 139799634
(5R)-5-(azidomethyl)-3-[3-fluoro-4-[4-(2-phenylmethoxyacetyl)piperazin-1-yl]phenyl]-1,3-oxazolidin-2-one (PubChem CID 139799634) has the molecular formula C23H25FN6O4 and a molecular weight of 468.49 g/mol. Its IUPAC name is (5R)-5-(azidomethyl)-3-[3-fluoro-4-[4-(2-phenylmethoxyacetyl)piperazin-1-yl]phenyl]-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-(azidomethyl)-3-[3-fluoro-4-[4-(2-phenylmethoxyacetyl)piperazin-1-yl]phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139799634 |
| Molecular Formula | C23H25FN6O4 |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | (5R)-5-(azidomethyl)-3-[3-fluoro-4-[4-(2-phenylmethoxyacetyl)piperazin-1-yl]phenyl]-1,3-oxazolidin-2-one |
| SMILES | [N-]=[N+]=NC[C@H]1CN(c2ccc(N3CCN(C(=O)COCc4ccccc4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C23H25FN6O4/c24-20-12-18(30-14-19(13-26-27-25)34-23(30)32)6-7-21(20)28-8-10-29(11-9-28)22(31)16-33-15-17-4-2-1-3-5-17/h1-7,12,19H,8-11,13-16H2/t19-/m0/s1 |
| InChIKey | YGLBQFKZHRZLEK-IBGZPJMESA-N |
| XLogP | 3.33 |
| TPSA | 111.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|