C15H23F2N3 — CID 63077484
[4-(4-tert-butylpiperazin-1-yl)-3,5-difluorophenyl]methanamine (PubChem CID 63077484) has the molecular formula C15H23F2N3 and a molecular weight of 283.37 g/mol. Its IUPAC name is [4-(4-tert-butylpiperazin-1-yl)-3,5-difluorophenyl]methanamine.
| Compound Name | [4-(4-tert-butylpiperazin-1-yl)-3,5-difluorophenyl]methanamine |
|---|---|
| PubChem CID | 63077484 |
| Molecular Formula | C15H23F2N3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | [4-(4-tert-butylpiperazin-1-yl)-3,5-difluorophenyl]methanamine |
| SMILES | CC(C)(C)N1CCN(c2c(F)cc(CN)cc2F)CC1 |
| InChI | InChI=1S/C15H23F2N3/c1-15(2,3)20-6-4-19(5-7-20)14-12(16)8-11(10-18)9-13(14)17/h8-9H,4-7,10,18H2,1-3H3 |
| InChIKey | PFIJMYAMSKZORD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |