C16H22F2O6 — CID 118455142
2,6-difluoro-4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]benzaldehyde (PubChem CID 118455142) has the molecular formula C16H22F2O6 and a molecular weight of 348.34 g/mol. Its IUPAC name is 2,6-difluoro-4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]benzaldehyde.
| Compound Name | 2,6-difluoro-4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]benzaldehyde |
|---|---|
| PubChem CID | 118455142 |
| Molecular Formula | C16H22F2O6 |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2,6-difluoro-4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]benzaldehyde |
| SMILES | COCCOCCOCCOCCOc1cc(F)c(C=O)c(F)c1 |
| InChI | InChI=1S/C16H22F2O6/c1-20-2-3-21-4-5-22-6-7-23-8-9-24-13-10-15(17)14(12-19)16(18)11-13/h10-12H,2-9H2,1H3 |
| InChIKey | OIAUGHFUNHABIB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|