C14H20O4 — CID 155578590
2-[2-(2-methoxyethoxy)ethoxy]-3,5-dimethylbenzaldehyde (PubChem CID 155578590) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]-3,5-dimethylbenzaldehyde.
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]-3,5-dimethylbenzaldehyde |
|---|---|
| PubChem CID | 155578590 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]-3,5-dimethylbenzaldehyde |
| SMILES | COCCOCCOc1c(C)cc(C)cc1C=O |
| InChI | InChI=1S/C14H20O4/c1-11-8-12(2)14(13(9-11)10-15)18-7-6-17-5-4-16-3/h8-10H,4-7H2,1-3H3 |
| InChIKey | LRWUVASEHQTSFJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|