C22H38O12 — CID 169054321
3,4-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]cyclobut-3-ene-1,2-dione (PubChem CID 169054321) has the molecular formula C22H38O12 and a molecular weight of 494.53 g/mol. Its IUPAC name is 3,4-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]cyclobut-3-ene-1,2-dione.
| Compound Name | 3,4-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 169054321 |
| Molecular Formula | C22H38O12 |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 3,4-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]cyclobut-3-ene-1,2-dione |
| SMILES | COCCOCCOCCOCCOc1c(OCCOCCOCCOCCOC)c(=O)c1=O |
| InChI | InChI=1S/C22H38O12/c1-25-3-5-27-7-9-29-11-13-31-15-17-33-21-19(23)20(24)22(21)34-18-16-32-14-12-30-10-8-28-6-4-26-2/h3-18H2,1-2H3 |
| InChIKey | UJXZXYUXDQBKTK-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 126.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|