C20H26O8 — CID 132569255
2,3-bis[2-(2-methoxyethoxy)ethoxy]naphthalene-1,4-dione (PubChem CID 132569255) has the molecular formula C20H26O8 and a molecular weight of 394.42 g/mol. Its IUPAC name is 2,3-bis[2-(2-methoxyethoxy)ethoxy]naphthalene-1,4-dione.
| Compound Name | 2,3-bis[2-(2-methoxyethoxy)ethoxy]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 132569255 |
| Molecular Formula | C20H26O8 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 2,3-bis[2-(2-methoxyethoxy)ethoxy]naphthalene-1,4-dione |
| SMILES | COCCOCCOC1=C(OCCOCCOC)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H26O8/c1-23-7-9-25-11-13-27-19-17(21)15-5-3-4-6-16(15)18(22)20(19)28-14-12-26-10-8-24-2/h3-6H,7-14H2,1-2H3 |
| InChIKey | LXWPDUFDXPJLSM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|