About 1-methoxy-2-(2-methoxyethoxy)ethane;thioxanthen-9-one
1-methoxy-2-(2-methoxyethoxy)ethane;thioxanthen-9-one (PubChem CID 165009765) has the molecular formula C19H22O4S
and a molecular weight of 346.45 g/mol. Its IUPAC name is 1-methoxy-2-(2-methoxyethoxy)ethane;thioxanthen-9-one.
Molecular Properties
| Compound Name | 1-methoxy-2-(2-methoxyethoxy)ethane;thioxanthen-9-one |
| PubChem CID | 165009765 |
| Molecular Formula | C19H22O4S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 1-methoxy-2-(2-methoxyethoxy)ethane;thioxanthen-9-one |
| SMILES | COCCOCCOC.O=c1c2ccccc2sc2ccccc12 |
| InChI | InChI=1S/C13H8OS.C6H14O3/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;1-7-3-5-9-6-4-8-2/h1-8H;3-6H2,1-2H3 |
| InChIKey | JNERUWGHJTUHKV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-2-(2-methoxyethoxy)ethane;thioxanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-2-(2-methoxyethoxy)ethane;thioxanthen-9-one?
The IUPAC name of 1-methoxy-2-(2-methoxyethoxy)ethane;thioxanthen-9-one (CID 165009765) is 1-methoxy-2-(2-methoxyethoxy)ethane;thioxanthen-9-one.
What is the SMILES notation for 1-methoxy-2-(2-methoxyethoxy)ethane;thioxanthen-9-one?
The canonical SMILES for 1-methoxy-2-(2-methoxyethoxy)ethane;thioxanthen-9-one is COCCOCCOC.O=c1c2ccccc2sc2ccccc12.
What is the InChIKey of 1-methoxy-2-(2-methoxyethoxy)ethane;thioxanthen-9-one?
The InChIKey is JNERUWGHJTUHKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8OS.C6H14O3/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;1-7-3-5-9-6-4-8-2/h1-8H;3-6H2,1-2H3.
What are the key properties of 1-methoxy-2-(2-methoxyethoxy)ethane;thioxanthen-9-one?
1-methoxy-2-(2-methoxyethoxy)ethane;thioxanthen-9-one has a molecular weight of 346.45 g/mol, XLogP of 3.71, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-2-(2-methoxyethoxy)ethane;thioxanthen-9-one is sourced from PubChem (CID 165009765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).