C29H36O7S — CID 164913335
bis(2-butoxyethyl) 2-[(9-oxothioxanthen-2-yl)methyl]propanedioate (PubChem CID 164913335) has the molecular formula C29H36O7S and a molecular weight of 528.67 g/mol. Its IUPAC name is bis(2-butoxyethyl) 2-[(9-oxothioxanthen-2-yl)methyl]propanedioate.
| Compound Name | bis(2-butoxyethyl) 2-[(9-oxothioxanthen-2-yl)methyl]propanedioate |
|---|---|
| PubChem CID | 164913335 |
| Molecular Formula | C29H36O7S |
| Molecular Weight | 528.67 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | bis(2-butoxyethyl) 2-[(9-oxothioxanthen-2-yl)methyl]propanedioate |
| SMILES | CCCCOCCOC(=O)C(Cc1ccc2sc3ccccc3c(=O)c2c1)C(=O)OCCOCCCC |
| InChI | InChI=1S/C29H36O7S/c1-3-5-13-33-15-17-35-28(31)24(29(32)36-18-16-34-14-6-4-2)20-21-11-12-26-23(19-21)27(30)22-9-7-8-10-25(22)37-26/h7-12,19,24H,3-6,13-18,20H2,1-2H3 |
| InChIKey | VHSRHAJXBYNHOC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.67 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|