2-butoxyethyl 2-benzyl-3-methylbutanoate

C18H28O3 — CID 169153476

IUPAC2-butoxyethyl 2-benzyl-3-methylbutanoate
SMILESCCCCOCCOC(=O)C(Cc1ccccc1)C(C)C
InChIInChI=1S/C18H28O3/c1-4-5-11-20-12-13-21-18(19)17(15(2)3)14-16-9-7-6-8-10-16/h6-10,15,17H,4-5,11-14H2,1-3H3
InChIKeyIVYRYRHMACVPFB-UHFFFAOYSA-N
MW292.42 g/mol
LogP3.86
Rot. Bonds10

About 2-butoxyethyl 2-benzyl-3-methylbutanoate

2-butoxyethyl 2-benzyl-3-methylbutanoate (PubChem CID 169153476) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is 2-butoxyethyl 2-benzyl-3-methylbutanoate.

Molecular Properties

Compound Name2-butoxyethyl 2-benzyl-3-methylbutanoate
PubChem CID169153476
Molecular FormulaC18H28O3
Molecular Weight292.42 g/mol
Exact Mass292.20
IUPAC Name2-butoxyethyl 2-benzyl-3-methylbutanoate
SMILESCCCCOCCOC(=O)C(Cc1ccccc1)C(C)C
InChIInChI=1S/C18H28O3/c1-4-5-11-20-12-13-21-18(19)17(15(2)3)14-16-9-7-6-8-10-16/h6-10,15,17H,4-5,11-14H2,1-3H3
InChIKeyIVYRYRHMACVPFB-UHFFFAOYSA-N
XLogP3.86
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds10
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.42
LogP ≤ 53.86
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-butoxyethyl 2-benzyl-3-methylbutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-butoxyethyl 2-benzyl-3-methylbutanoate?
The IUPAC name of 2-butoxyethyl 2-benzyl-3-methylbutanoate (CID 169153476) is 2-butoxyethyl 2-benzyl-3-methylbutanoate.
What is the SMILES notation for 2-butoxyethyl 2-benzyl-3-methylbutanoate?
The canonical SMILES for 2-butoxyethyl 2-benzyl-3-methylbutanoate is CCCCOCCOC(=O)C(Cc1ccccc1)C(C)C.
What is the InChIKey of 2-butoxyethyl 2-benzyl-3-methylbutanoate?
The InChIKey is IVYRYRHMACVPFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O3/c1-4-5-11-20-12-13-21-18(19)17(15(2)3)14-16-9-7-6-8-10-16/h6-10,15,17H,4-5,11-14H2,1-3H3.
What are the key properties of 2-butoxyethyl 2-benzyl-3-methylbutanoate?
2-butoxyethyl 2-benzyl-3-methylbutanoate has a molecular weight of 292.42 g/mol, XLogP of 3.86, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxyethyl 2-benzyl-3-methylbutanoate is sourced from PubChem (CID 169153476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).