C25H42O7 — CID 159223718
[2-butoxy-3-(2-butoxyethoxy)propyl]benzene;hexanedioic acid (PubChem CID 159223718) has the molecular formula C25H42O7 and a molecular weight of 454.60 g/mol. Its IUPAC name is [2-butoxy-3-(2-butoxyethoxy)propyl]benzene;hexanedioic acid.
| Compound Name | [2-butoxy-3-(2-butoxyethoxy)propyl]benzene;hexanedioic acid |
|---|---|
| PubChem CID | 159223718 |
| Molecular Formula | C25H42O7 |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | [2-butoxy-3-(2-butoxyethoxy)propyl]benzene;hexanedioic acid |
| SMILES | CCCCOCCOCC(Cc1ccccc1)OCCCC.O=C(O)CCCCC(=O)O |
| InChI | InChI=1S/C19H32O3.C6H10O4/c1-3-5-12-20-14-15-21-17-19(22-13-6-4-2)16-18-10-8-7-9-11-18;7-5(8)3-1-2-4-6(9)10/h7-11,19H,3-6,12-17H2,1-2H3;1-4H2,(H,7,8)(H,9,10) |
| InChIKey | KSABPWNUKSJYIT-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|