C33H56O11 — CID 168985442
8-[(2S)-2-(7-carboxyheptoxy)-3-[2-[2-[2-(2-phenoxyethoxy)ethoxy]ethoxy]ethoxy]propoxy]octanoic acid (PubChem CID 168985442) has the molecular formula C33H56O11 and a molecular weight of 628.80 g/mol. Its IUPAC name is 8-[(2S)-2-(7-carboxyheptoxy)-3-[2-[2-[2-(2-phenoxyethoxy)ethoxy]ethoxy]ethoxy]propoxy]octanoic acid.
| Compound Name | 8-[(2S)-2-(7-carboxyheptoxy)-3-[2-[2-[2-(2-phenoxyethoxy)ethoxy]ethoxy]ethoxy]propoxy]octanoic acid |
|---|---|
| PubChem CID | 168985442 |
| Molecular Formula | C33H56O11 |
| Molecular Weight | 628.80 g/mol |
| Exact Mass | 628.38 |
| IUPAC Name | 8-[(2S)-2-(7-carboxyheptoxy)-3-[2-[2-[2-(2-phenoxyethoxy)ethoxy]ethoxy]ethoxy]propoxy]octanoic acid |
| SMILES | O=C(O)CCCCCCCOC[C@@H](COCCOCCOCCOCCOc1ccccc1)OCCCCCCCC(=O)O |
| InChI | InChI=1S/C33H56O11/c34-32(35)16-10-3-1-5-12-18-41-28-31(43-19-13-6-2-4-11-17-33(36)37)29-42-25-24-39-21-20-38-22-23-40-26-27-44-30-14-8-7-9-15-30/h7-9,14-15,31H,1-6,10-13,16-29H2,(H,34,35)(H,36,37)/t31-/m0/s1 |
| InChIKey | SVOJYZCPHXPUTD-HKBQPEDESA-N |
| XLogP | 5.38 |
| TPSA | 139.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.80 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|