C22H37NO6 — CID 164592889
5-[2-[2-[6-[3-(aminomethyl)phenoxy]hexoxy]ethoxy]ethoxy]pentanoic acid (PubChem CID 164592889) has the molecular formula C22H37NO6 and a molecular weight of 411.54 g/mol. Its IUPAC name is 5-[2-[2-[6-[3-(aminomethyl)phenoxy]hexoxy]ethoxy]ethoxy]pentanoic acid.
| Compound Name | 5-[2-[2-[6-[3-(aminomethyl)phenoxy]hexoxy]ethoxy]ethoxy]pentanoic acid |
|---|---|
| PubChem CID | 164592889 |
| Molecular Formula | C22H37NO6 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | 5-[2-[2-[6-[3-(aminomethyl)phenoxy]hexoxy]ethoxy]ethoxy]pentanoic acid |
| SMILES | NCc1cccc(OCCCCCCOCCOCCOCCCCC(=O)O)c1 |
| InChI | InChI=1S/C22H37NO6/c23-19-20-8-7-9-21(18-20)29-13-5-2-1-4-11-26-14-16-28-17-15-27-12-6-3-10-22(24)25/h7-9,18H,1-6,10-17,19,23H2,(H,24,25) |
| InChIKey | WYJJJFJYTWIDAG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|