C20H34ClNO8 — CID 164593214
3-[2-[2-[2-[2-[2-[3-(aminomethyl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid;hydrochloride (PubChem CID 164593214) has the molecular formula C20H34ClNO8 and a molecular weight of 451.94 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-[2-[3-(aminomethyl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid;hydrochloride.
| Compound Name | 3-[2-[2-[2-[2-[2-[3-(aminomethyl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 164593214 |
| Molecular Formula | C20H34ClNO8 |
| Molecular Weight | 451.94 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 3-[2-[2-[2-[2-[2-[3-(aminomethyl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid;hydrochloride |
| SMILES | Cl.NCc1cccc(OCCOCCOCCOCCOCCOCCC(=O)O)c1 |
| InChI | InChI=1S/C20H33NO8.ClH/c21-17-18-2-1-3-19(16-18)29-15-14-28-13-12-27-11-10-26-9-8-25-7-6-24-5-4-20(22)23;/h1-3,16H,4-15,17,21H2,(H,22,23);1H |
| InChIKey | HLBPCKYHMQKMQX-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 118.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.94 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|