C21H36ClNO6 — CID 164593161
methyl 3-[2-[2-[6-[3-(aminomethyl)phenoxy]hexoxy]ethoxy]ethoxy]propanoate;hydrochloride (PubChem CID 164593161) has the molecular formula C21H36ClNO6 and a molecular weight of 433.97 g/mol. Its IUPAC name is methyl 3-[2-[2-[6-[3-(aminomethyl)phenoxy]hexoxy]ethoxy]ethoxy]propanoate;hydrochloride.
| Compound Name | methyl 3-[2-[2-[6-[3-(aminomethyl)phenoxy]hexoxy]ethoxy]ethoxy]propanoate;hydrochloride |
|---|---|
| PubChem CID | 164593161 |
| Molecular Formula | C21H36ClNO6 |
| Molecular Weight | 433.97 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | methyl 3-[2-[2-[6-[3-(aminomethyl)phenoxy]hexoxy]ethoxy]ethoxy]propanoate;hydrochloride |
| SMILES | COC(=O)CCOCCOCCOCCCCCCOc1cccc(CN)c1.Cl |
| InChI | InChI=1S/C21H35NO6.ClH/c1-24-21(23)9-12-26-14-16-27-15-13-25-10-4-2-3-5-11-28-20-8-6-7-19(17-20)18-22;/h6-8,17H,2-5,9-16,18,22H2,1H3;1H |
| InChIKey | BLICLNOGRMLVJT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.97 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|